C23H32N2O2 — CID 6572885
(3S,3aR,8aR,9aR)-5,8a-dimethyl-3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 6572885) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is (3S,3aR,8aR,9aR)-5,8a-dimethyl-3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aR,8aR,9aR)-5,8a-dimethyl-3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 6572885 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | (3S,3aR,8aR,9aR)-5,8a-dimethyl-3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=C2C[C@H]3[C@@H](C[C@@]2(C)CCC1)OC(=O)[C@@H]3CN(C)CCc1ccccn1 |
| InChI | InChI=1S/C23H32N2O2/c1-16-7-6-10-23(2)14-21-18(13-20(16)23)19(22(26)27-21)15-25(3)12-9-17-8-4-5-11-24-17/h4-5,8,11,18-19,21H,6-7,9-10,12-15H2,1-3H3/t18-,19-,21-,23-/m1/s1 |
| InChIKey | HVDXBYCQTJYUKM-LUBSMZHTSA-N |
| XLogP | 4.01 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|