C22H21FN2O4 — CID 118708526
N-(2-fluoro-4-pyridin-3-ylphenyl)-3,4,5-trimethoxy-N-methylbenzamide (PubChem CID 118708526) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is N-(2-fluoro-4-pyridin-3-ylphenyl)-3,4,5-trimethoxy-N-methylbenzamide.
| Compound Name | N-(2-fluoro-4-pyridin-3-ylphenyl)-3,4,5-trimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 118708526 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-(2-fluoro-4-pyridin-3-ylphenyl)-3,4,5-trimethoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)c2ccc(-c3cccnc3)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C22H21FN2O4/c1-25(18-8-7-14(10-17(18)23)15-6-5-9-24-13-15)22(26)16-11-19(27-2)21(29-4)20(12-16)28-3/h5-13H,1-4H3 |
| InChIKey | BOSTUWJUUIFRJM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |