C23H19FN4O2 — CID 118709308
1-[6-[(4-fluorophenyl)methoxy]quinazolin-7-yl]-3-(4-methylphenyl)urea (PubChem CID 118709308) has the molecular formula C23H19FN4O2 and a molecular weight of 402.43 g/mol. Its IUPAC name is 1-[6-[(4-fluorophenyl)methoxy]quinazolin-7-yl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[6-[(4-fluorophenyl)methoxy]quinazolin-7-yl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 118709308 |
| Molecular Formula | C23H19FN4O2 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[6-[(4-fluorophenyl)methoxy]quinazolin-7-yl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc3ncncc3cc2OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H19FN4O2/c1-15-2-8-19(9-3-15)27-23(29)28-21-11-20-17(12-25-14-26-20)10-22(21)30-13-16-4-6-18(24)7-5-16/h2-12,14H,13H2,1H3,(H2,27,28,29) |
| InChIKey | ZHLQFQWSONKMGT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |