C19H12ClNO4 — CID 118709877
6-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methoxy]chromen-2-one (PubChem CID 118709877) has the molecular formula C19H12ClNO4 and a molecular weight of 353.76 g/mol. Its IUPAC name is 6-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methoxy]chromen-2-one.
| Compound Name | 6-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 118709877 |
| Molecular Formula | C19H12ClNO4 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 6-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methoxy]chromen-2-one |
| SMILES | O=c1ccc2cc(OCc3cc(-c4cccc(Cl)c4)no3)ccc2o1 |
| InChI | InChI=1S/C19H12ClNO4/c20-14-3-1-2-12(8-14)17-10-16(25-21-17)11-23-15-5-6-18-13(9-15)4-7-19(22)24-18/h1-10H,11H2 |
| InChIKey | XOCWGWWXAVCRRI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|