C19H17ClIN3O3 — CID 153178437
(2S)-3-[4-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methoxy]phenyl]-2-(iodoamino)propanamide (PubChem CID 153178437) has the molecular formula C19H17ClIN3O3 and a molecular weight of 497.72 g/mol. Its IUPAC name is (2S)-3-[4-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methoxy]phenyl]-2-(iodoamino)propanamide.
| Compound Name | (2S)-3-[4-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methoxy]phenyl]-2-(iodoamino)propanamide |
|---|---|
| PubChem CID | 153178437 |
| Molecular Formula | C19H17ClIN3O3 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | (2S)-3-[4-[[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methoxy]phenyl]-2-(iodoamino)propanamide |
| SMILES | NC(=O)[C@H](Cc1ccc(OCc2cc(-c3cccc(Cl)c3)no2)cc1)NI |
| InChI | InChI=1S/C19H17ClIN3O3/c20-14-3-1-2-13(9-14)17-10-16(27-24-17)11-26-15-6-4-12(5-7-15)8-18(23-21)19(22)25/h1-7,9-10,18,23H,8,11H2,(H2,22,25)/t18-/m0/s1 |
| InChIKey | WFRDLFLGNIOBGC-SFHVURJKSA-N |
| XLogP | 3.91 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|