C30H43N5O — CID 118710462
N-[4-[4-(3,5-ditert-butylphenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 118710462) has the molecular formula C30H43N5O and a molecular weight of 489.71 g/mol. Its IUPAC name is N-[4-[4-(3,5-ditert-butylphenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[4-[4-(3,5-ditert-butylphenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118710462 |
| Molecular Formula | C30H43N5O |
| Molecular Weight | 489.71 g/mol |
| Exact Mass | 489.35 |
| IUPAC Name | N-[4-[4-(3,5-ditert-butylphenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CC(C)(C)c1cc(N2CCN(CCCCNC(=O)c3cn4ccccc4n3)CC2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H43N5O/c1-29(2,3)23-19-24(30(4,5)6)21-25(20-23)34-17-15-33(16-18-34)13-10-8-12-31-28(36)26-22-35-14-9-7-11-27(35)32-26/h7,9,11,14,19-22H,8,10,12-13,15-18H2,1-6H3,(H,31,36) |
| InChIKey | QZCUWLCSQMYXFR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.71 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|