C27H30N2O5 — CID 118710575
ethyl 5-[4-[4-(oxan-4-yl)benzoyl]piperazin-1-yl]-1-benzofuran-2-carboxylate (PubChem CID 118710575) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is ethyl 5-[4-[4-(oxan-4-yl)benzoyl]piperazin-1-yl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[4-[4-(oxan-4-yl)benzoyl]piperazin-1-yl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 118710575 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | ethyl 5-[4-[4-(oxan-4-yl)benzoyl]piperazin-1-yl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(N3CCN(C(=O)c4ccc(C5CCOCC5)cc4)CC3)ccc2o1 |
| InChI | InChI=1S/C27H30N2O5/c1-2-33-27(31)25-18-22-17-23(7-8-24(22)34-25)28-11-13-29(14-12-28)26(30)21-5-3-19(4-6-21)20-9-15-32-16-10-20/h3-8,17-18,20H,2,9-16H2,1H3 |
| InChIKey | BUIMKNRWZIHCPC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |