C22H25ClN2O3 — CID 6603493
ethyl 3-[(4-phenylpiperazin-1-yl)methyl]-1-benzofuran-2-carboxylate;hydrochloride (PubChem CID 6603493) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is ethyl 3-[(4-phenylpiperazin-1-yl)methyl]-1-benzofuran-2-carboxylate;hydrochloride.
| Compound Name | ethyl 3-[(4-phenylpiperazin-1-yl)methyl]-1-benzofuran-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 6603493 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | ethyl 3-[(4-phenylpiperazin-1-yl)methyl]-1-benzofuran-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1oc2ccccc2c1CN1CCN(c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C22H24N2O3.ClH/c1-2-26-22(25)21-19(18-10-6-7-11-20(18)27-21)16-23-12-14-24(15-13-23)17-8-4-3-5-9-17;/h3-11H,2,12-16H2,1H3;1H |
| InChIKey | SYWRZMBRWILFHN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |