C22H20Cl2N2O4 — CID 118710630
ethyl 5-[4-(2,6-dichlorobenzoyl)piperazin-1-yl]-1-benzofuran-2-carboxylate (PubChem CID 118710630) has the molecular formula C22H20Cl2N2O4 and a molecular weight of 447.32 g/mol. Its IUPAC name is ethyl 5-[4-(2,6-dichlorobenzoyl)piperazin-1-yl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[4-(2,6-dichlorobenzoyl)piperazin-1-yl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 118710630 |
| Molecular Formula | C22H20Cl2N2O4 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | ethyl 5-[4-(2,6-dichlorobenzoyl)piperazin-1-yl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(N3CCN(C(=O)c4c(Cl)cccc4Cl)CC3)ccc2o1 |
| InChI | InChI=1S/C22H20Cl2N2O4/c1-2-29-22(28)19-13-14-12-15(6-7-18(14)30-19)25-8-10-26(11-9-25)21(27)20-16(23)4-3-5-17(20)24/h3-7,12-13H,2,8-11H2,1H3 |
| InChIKey | AIWJSZPTYZKHGS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |