C22H23N3O3S — CID 118721089
ethyl 5-[4-(phenylcarbamothioyl)piperazin-1-yl]-1-benzofuran-2-carboxylate (PubChem CID 118721089) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is ethyl 5-[4-(phenylcarbamothioyl)piperazin-1-yl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[4-(phenylcarbamothioyl)piperazin-1-yl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 118721089 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | ethyl 5-[4-(phenylcarbamothioyl)piperazin-1-yl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(N3CCN(C(=S)Nc4ccccc4)CC3)ccc2o1 |
| InChI | InChI=1S/C22H23N3O3S/c1-2-27-21(26)20-15-16-14-18(8-9-19(16)28-20)24-10-12-25(13-11-24)22(29)23-17-6-4-3-5-7-17/h3-9,14-15H,2,10-13H2,1H3,(H,23,29) |
| InChIKey | XJDBQBUNNKLDLH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|