C22H35ClN2O — CID 118711484
3-cyclopentyl-N-[4-(dimethylamino)-4-phenylcyclohexyl]propanamide;hydrochloride (PubChem CID 118711484) has the molecular formula C22H35ClN2O and a molecular weight of 378.99 g/mol. Its IUPAC name is 3-cyclopentyl-N-[4-(dimethylamino)-4-phenylcyclohexyl]propanamide;hydrochloride.
| Compound Name | 3-cyclopentyl-N-[4-(dimethylamino)-4-phenylcyclohexyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 118711484 |
| Molecular Formula | C22H35ClN2O |
| Molecular Weight | 378.99 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 3-cyclopentyl-N-[4-(dimethylamino)-4-phenylcyclohexyl]propanamide;hydrochloride |
| SMILES | CN(C)C1(c2ccccc2)CCC(NC(=O)CCC2CCCC2)CC1.Cl |
| InChI | InChI=1S/C22H34N2O.ClH/c1-24(2)22(19-10-4-3-5-11-19)16-14-20(15-17-22)23-21(25)13-12-18-8-6-7-9-18;/h3-5,10-11,18,20H,6-9,12-17H2,1-2H3,(H,23,25);1H |
| InChIKey | POYPDTXDBVYRTA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.99 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |