C10H24NO9P — CID 118712214
azanium 2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]oxyethoxy-methylphosphinate (PubChem CID 118712214) has the molecular formula C10H24NO9P and a molecular weight of 333.27 g/mol. Its IUPAC name is azanium 2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]oxyethoxy-methylphosphinate.
| Compound Name | azanium 2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]oxyethoxy-methylphosphinate |
|---|---|
| PubChem CID | 118712214 |
| Molecular Formula | C10H24NO9P |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | azanium 2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]oxyethoxy-methylphosphinate |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](OCCOP(C)(=O)[O-])[C@H]1O.[NH4+] |
| InChI | InChI=1S/C10H21O9P.H3N/c1-16-10-8(13)9(7(12)6(5-11)19-10)17-3-4-18-20(2,14)15;/h6-13H,3-5H2,1-2H3,(H,14,15);1H3/t6-,7+,8-,9+,10-;/m1./s1 |
| InChIKey | VKKWCDZEBHGVAS-ACVTYYADSA-N |
| XLogP | -1.97 |
| TPSA | 174.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|