C23H27N3 — CID 118712263
(1R,9aR)-1-[(1-phenylbenzimidazol-2-yl)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 118712263) has the molecular formula C23H27N3 and a molecular weight of 345.49 g/mol. Its IUPAC name is (1R,9aR)-1-[(1-phenylbenzimidazol-2-yl)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (1R,9aR)-1-[(1-phenylbenzimidazol-2-yl)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 118712263 |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (1R,9aR)-1-[(1-phenylbenzimidazol-2-yl)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | c1ccc(-n2c(C[C@H]3CCCN4CCCC[C@H]34)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H27N3/c1-2-10-19(11-3-1)26-22-14-5-4-12-20(22)24-23(26)17-18-9-8-16-25-15-7-6-13-21(18)25/h1-5,10-12,14,18,21H,6-9,13,15-17H2/t18-,21-/m1/s1 |
| InChIKey | PFHCXDJMWPEVPE-WIYYLYMNSA-N |
| XLogP | 4.83 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |