C18H17N3OS — CID 118713910
(2E)-3-benzyl-2-[(Z)-1-phenylethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 118713910) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is (2E)-3-benzyl-2-[(Z)-1-phenylethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-3-benzyl-2-[(Z)-1-phenylethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118713910 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2E)-3-benzyl-2-[(Z)-1-phenylethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | C/C(=N/N=C1/SCC(=O)N1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3OS/c1-14(16-10-6-3-7-11-16)19-20-18-21(17(22)13-23-18)12-15-8-4-2-5-9-15/h2-11H,12-13H2,1H3/b19-14-,20-18+ |
| InChIKey | CWFZBPPOELFHNU-COVIGOSBSA-N |
| XLogP | 3.54 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|