C22H21N3O4 — CID 118714591
3-[(4-aminopiperidin-1-yl)methyl]-4,11-dihydroxy-1H-naphtho[2,3-f]indole-5,10-dione (PubChem CID 118714591) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-[(4-aminopiperidin-1-yl)methyl]-4,11-dihydroxy-1H-naphtho[2,3-f]indole-5,10-dione.
| Compound Name | 3-[(4-aminopiperidin-1-yl)methyl]-4,11-dihydroxy-1H-naphtho[2,3-f]indole-5,10-dione |
|---|---|
| PubChem CID | 118714591 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-[(4-aminopiperidin-1-yl)methyl]-4,11-dihydroxy-1H-naphtho[2,3-f]indole-5,10-dione |
| SMILES | NC1CCN(Cc2c[nH]c3c(O)c4c(c(O)c23)C(=O)c2ccccc2C4=O)CC1 |
| InChI | InChI=1S/C22H21N3O4/c23-12-5-7-25(8-6-12)10-11-9-24-18-15(11)21(28)16-17(22(18)29)20(27)14-4-2-1-3-13(14)19(16)26/h1-4,9,12,24,28-29H,5-8,10,23H2 |
| InChIKey | FQHJTRQJAVWBJV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|