C25H22N4O3S3 — CID 118715437
1-benzyl-3-[4-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)phenyl]sulfonylurea (PubChem CID 118715437) has the molecular formula C25H22N4O3S3 and a molecular weight of 522.68 g/mol. Its IUPAC name is 1-benzyl-3-[4-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)phenyl]sulfonylurea.
| Compound Name | 1-benzyl-3-[4-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 118715437 |
| Molecular Formula | C25H22N4O3S3 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 1-benzyl-3-[4-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)phenyl]sulfonylurea |
| SMILES | O=C(NCc1ccccc1)NS(=O)(=O)c1ccc(N2N=C(c3cccs3)CC2c2cccs2)cc1 |
| InChI | InChI=1S/C25H22N4O3S3/c30-25(26-17-18-6-2-1-3-7-18)28-35(31,32)20-12-10-19(11-13-20)29-22(24-9-5-15-34-24)16-21(27-29)23-8-4-14-33-23/h1-15,22H,16-17H2,(H2,26,28,30) |
| InChIKey | CVFYAQUBTHXFEH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |