C19H14Cl2N2S — CID 45356708
2,3-bis(4-chlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole (PubChem CID 45356708) has the molecular formula C19H14Cl2N2S and a molecular weight of 373.31 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole.
| Compound Name | 2,3-bis(4-chlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 45356708 |
| Molecular Formula | C19H14Cl2N2S |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole |
| SMILES | Clc1ccc(C2CC(c3cccs3)=NN2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H14Cl2N2S/c20-14-5-3-13(4-6-14)18-12-17(19-2-1-11-24-19)22-23(18)16-9-7-15(21)8-10-16/h1-11,18H,12H2 |
| InChIKey | DJYZXHAHQNCNNR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |