C19H18N2OS — CID 118716532
N-methyl-N,5-bis(3-methylphenyl)-1,3-thiazole-2-carboxamide (PubChem CID 118716532) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is N-methyl-N,5-bis(3-methylphenyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-methyl-N,5-bis(3-methylphenyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 118716532 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-methyl-N,5-bis(3-methylphenyl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cccc(-c2cnc(C(=O)N(C)c3cccc(C)c3)s2)c1 |
| InChI | InChI=1S/C19H18N2OS/c1-13-6-4-8-15(10-13)17-12-20-18(23-17)19(22)21(3)16-9-5-7-14(2)11-16/h4-12H,1-3H3 |
| InChIKey | GCSQBORILKREQY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |