C17H16ClN3O — CID 118717218
N-(diaminomethylidene)spiro[cyclopropane-1,9'-fluorene]-2'-carboxamide;hydrochloride (PubChem CID 118717218) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is N-(diaminomethylidene)spiro[cyclopropane-1,9'-fluorene]-2'-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)spiro[cyclopropane-1,9'-fluorene]-2'-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118717218 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-(diaminomethylidene)spiro[cyclopropane-1,9'-fluorene]-2'-carboxamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1ccc2c(c1)C1(CC1)c1ccccc1-2 |
| InChI | InChI=1S/C17H15N3O.ClH/c18-16(19)20-15(21)10-5-6-12-11-3-1-2-4-13(11)17(7-8-17)14(12)9-10;/h1-6,9H,7-8H2,(H4,18,19,20,21);1H |
| InChIKey | UKHMQGVNMNPFNO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|