C18H25F3N2O4 — CID 118718246
[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4,5-trimethyl-1H-pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 118718246) has the molecular formula C18H25F3N2O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4,5-trimethyl-1H-pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4,5-trimethyl-1H-pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118718246 |
| Molecular Formula | C18H25F3N2O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4,5-trimethyl-1H-pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | Cc1[nH]c(C)c(C(=O)OC2C[C@H]3CC[C@@H](C2)N3C)c1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N2O2.C2HF3O2/c1-9-10(2)17-11(3)15(9)16(19)20-14-7-12-5-6-13(8-14)18(12)4;3-2(4,5)1(6)7/h12-14,17H,5-8H2,1-4H3;(H,6,7)/t12-,13+,14?; |
| InChIKey | RTGZPJXFPYOIAS-LIWIJTDLSA-N |
| XLogP | 3.36 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |