C13H13FN2O2 — CID 118719550
(4S,8aS)-4-(3-fluorophenyl)-6,7,8,8a-tetrahydro-4H-pyrrolo[1,2-a]pyrazine-1,3-dione (PubChem CID 118719550) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is (4S,8aS)-4-(3-fluorophenyl)-6,7,8,8a-tetrahydro-4H-pyrrolo[1,2-a]pyrazine-1,3-dione.
| Compound Name | (4S,8aS)-4-(3-fluorophenyl)-6,7,8,8a-tetrahydro-4H-pyrrolo[1,2-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 118719550 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (4S,8aS)-4-(3-fluorophenyl)-6,7,8,8a-tetrahydro-4H-pyrrolo[1,2-a]pyrazine-1,3-dione |
| SMILES | O=C1NC(=O)[C@@H]2CCCN2[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C13H13FN2O2/c14-9-4-1-3-8(7-9)11-13(18)15-12(17)10-5-2-6-16(10)11/h1,3-4,7,10-11H,2,5-6H2,(H,15,17,18)/t10-,11-/m0/s1 |
| InChIKey | VLYDIJBRMGIRGI-QWRGUYRKSA-N |
| XLogP | 0.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|