C14H23N5 — CID 118720440
4-N-cyclopentyl-6-piperidin-4-ylpyrimidine-2,4-diamine (PubChem CID 118720440) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-piperidin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopentyl-6-piperidin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118720440 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 4-N-cyclopentyl-6-piperidin-4-ylpyrimidine-2,4-diamine |
| SMILES | Nc1nc(NC2CCCC2)cc(C2CCNCC2)n1 |
| InChI | InChI=1S/C14H23N5/c15-14-18-12(10-5-7-16-8-6-10)9-13(19-14)17-11-3-1-2-4-11/h9-11,16H,1-8H2,(H3,15,17,18,19) |
| InChIKey | OHYDSBSSHDUAPM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |