C22H14N2O2S — CID 118720478
4-(2-hydroxy-3-pyridin-3-ylnaphthalen-1-yl)sulfinylbenzonitrile (PubChem CID 118720478) has the molecular formula C22H14N2O2S and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-(2-hydroxy-3-pyridin-3-ylnaphthalen-1-yl)sulfinylbenzonitrile.
| Compound Name | 4-(2-hydroxy-3-pyridin-3-ylnaphthalen-1-yl)sulfinylbenzonitrile |
|---|---|
| PubChem CID | 118720478 |
| Molecular Formula | C22H14N2O2S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-(2-hydroxy-3-pyridin-3-ylnaphthalen-1-yl)sulfinylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)c2c(O)c(-c3cccnc3)cc3ccccc23)cc1 |
| InChI | InChI=1S/C22H14N2O2S/c23-13-15-7-9-18(10-8-15)27(26)22-19-6-2-1-4-16(19)12-20(21(22)25)17-5-3-11-24-14-17/h1-12,14,25H |
| InChIKey | WCWACTFHCNTRLH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |