C29H52N12O5S — CID 118721649
Ac-Lys-Arg-Leu-Arg-thiazol-2-yl (PubChem CID 118721649) has the molecular formula C29H52N12O5S and a molecular weight of 680.90 g/mol. Its IUPAC name is (2S)-2-acetamido-6-amino-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]hexanamide.
| Compound Name | Ac-Lys-Arg-Leu-Arg-thiazol-2-yl |
|---|---|
| PubChem CID | 118721649 |
| Molecular Formula | C29H52N12O5S |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | (2S)-2-acetamido-6-amino-N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]hexanamide |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)C1=NC=CS1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCCN)NC(=O)C |
| InChI | InChI=1S/C29H52N12O5S/c1-17(2)16-22(26(46)39-19(9-6-12-36-28(31)32)23(43)27-35-14-15-47-27)41-25(45)21(10-7-13-37-29(33)34)40-24(44)20(38-18(3)42)8-4-5-11-30/h14-15,17,19-22H,4-13,16,30H2,1-3H3,(H,38,42)(H,39,46)(H,40,44)(H,41,45)(H4,31,32,36)(H4,33,34,37)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | DIOWGKUHSWDAQR-CMOCDZPBSA-N |
| XLogP | -1.40 |
| TPSA | 329.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | 1080 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|