C28H48N10O6S — CID 127042186
Ac-Lys-Gln-Leu-D-Arg-thiazol-2-yl (PubChem CID 127042186) has the molecular formula C28H48N10O6S and a molecular weight of 652.80 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-N-[(2S)-1-[[(2R)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pentanediamide.
| Compound Name | Ac-Lys-Gln-Leu-D-Arg-thiazol-2-yl |
|---|---|
| PubChem CID | 127042186 |
| Molecular Formula | C28H48N10O6S |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-N-[(2S)-1-[[(2R)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pentanediamide |
| SMILES | CC(C)C[C@@H](C(=O)N[C@H](CCCN=C(N)N)C(=O)C1=NC=CS1)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](CCCCN)NC(=O)C |
| InChI | InChI=1S/C28H48N10O6S/c1-16(2)15-21(26(44)36-18(8-6-12-34-28(31)32)23(41)27-33-13-14-45-27)38-25(43)20(9-10-22(30)40)37-24(42)19(35-17(3)39)7-4-5-11-29/h13-14,16,18-21H,4-12,15,29H2,1-3H3,(H2,30,40)(H,35,39)(H,36,44)(H,37,42)(H,38,43)(H4,31,32,34)/t18-,19+,20+,21+/m1/s1 |
| InChIKey | PFSNIQDNVQKULM-ANULTFPQSA-N |
| XLogP | -1.30 |
| TPSA | 308.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | 1040 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|