C19H30N10O4S — CID 44376700
2-[(R)-3-(3-Guanidino-propyl)-2,5-dioxo-piperazin-1-yl]-N-[(S)-4-guanidino-1-(thiazole-2-carbonyl)-butyl]-acetamide (PubChem CID 44376700) has the molecular formula C19H30N10O4S and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetamide.
| Compound Name | 2-[(R)-3-(3-Guanidino-propyl)-2,5-dioxo-piperazin-1-yl]-N-[(S)-4-guanidino-1-(thiazole-2-carbonyl)-butyl]-acetamide |
|---|---|
| PubChem CID | 44376700 |
| Molecular Formula | C19H30N10O4S |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetamide |
| SMILES | C1C(=O)N[C@@H](C(=O)N1CC(=O)N[C@@H](CCCN=C(N)N)C(=O)C2=NC=CS2)CCCN=C(N)N |
| InChI | InChI=1S/C19H30N10O4S/c20-18(21)25-5-1-3-11(15(32)16-24-7-8-34-16)27-13(30)9-29-10-14(31)28-12(17(29)33)4-2-6-26-19(22)23/h7-8,11-12H,1-6,9-10H2,(H,27,30)(H,28,31)(H4,20,21,25)(H4,22,23,26)/t11-,12+/m0/s1 |
| InChIKey | UIIAELWWMHGQNR-NWDGAFQWSA-N |
| XLogP | -2.60 |
| TPSA | 266.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | 813 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|