C22H36N8O5S — CID 127042542
Ac-Gln-Leu-D-Arg-thiazol-2-yl (PubChem CID 127042542) has the molecular formula C22H36N8O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2S)-1-[[(2R)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pentanediamide.
| Compound Name | Ac-Gln-Leu-D-Arg-thiazol-2-yl |
|---|---|
| PubChem CID | 127042542 |
| Molecular Formula | C22H36N8O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | (2S)-2-acetamido-N-[(2S)-1-[[(2R)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pentanediamide |
| SMILES | CC(C)C[C@@H](C(=O)N[C@H](CCCN=C(N)N)C(=O)C1=NC=CS1)NC(=O)[C@H](CCC(=O)N)NC(=O)C |
| InChI | InChI=1S/C22H36N8O5S/c1-12(2)11-16(30-19(34)15(28-13(3)31)6-7-17(23)32)20(35)29-14(5-4-8-27-22(24)25)18(33)21-26-9-10-36-21/h9-10,12,14-16H,4-8,11H2,1-3H3,(H2,23,32)(H,28,31)(H,29,35)(H,30,34)(H4,24,25,27)/t14-,15+,16+/m1/s1 |
| InChIKey | DXOAHXROMGLONQ-PMPSAXMXSA-N |
| XLogP | -0.80 |
| TPSA | 253.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | 818 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|