C20H28N4O — CID 118722998
1-methyl-4-[3-(6-methyl-2-phenylpyrimidin-4-yl)oxypropyl]-1,4-diazepane (PubChem CID 118722998) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-methyl-4-[3-(6-methyl-2-phenylpyrimidin-4-yl)oxypropyl]-1,4-diazepane.
| Compound Name | 1-methyl-4-[3-(6-methyl-2-phenylpyrimidin-4-yl)oxypropyl]-1,4-diazepane |
|---|---|
| PubChem CID | 118722998 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 1-methyl-4-[3-(6-methyl-2-phenylpyrimidin-4-yl)oxypropyl]-1,4-diazepane |
| SMILES | Cc1cc(OCCCN2CCCN(C)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H28N4O/c1-17-16-19(22-20(21-17)18-8-4-3-5-9-18)25-15-7-12-24-11-6-10-23(2)13-14-24/h3-5,8-9,16H,6-7,10-15H2,1-2H3 |
| InChIKey | WPCZIUFPITVLJB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|