C15H13FN4 — CID 118726300
4-[(4-fluorophenyl)methyl]-5-phenyl-1,2,4-triazol-3-amine (PubChem CID 118726300) has the molecular formula C15H13FN4 and a molecular weight of 268.30 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-5-phenyl-1,2,4-triazol-3-amine.
| Compound Name | 4-[(4-fluorophenyl)methyl]-5-phenyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 118726300 |
| Molecular Formula | C15H13FN4 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-5-phenyl-1,2,4-triazol-3-amine |
| SMILES | Nc1nnc(-c2ccccc2)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H13FN4/c16-13-8-6-11(7-9-13)10-20-14(18-19-15(20)17)12-4-2-1-3-5-12/h1-9H,10H2,(H2,17,19) |
| InChIKey | JTUSDYFYYLLAOA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |