About 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one
5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one (PubChem CID 118726457) has the molecular formula C12H12O4
and a molecular weight of 220.22 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one.
Molecular Properties
| Compound Name | 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one |
| PubChem CID | 118726457 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OCCc2c1cccc2C1OCCO1 |
| InChI | InChI=1S/C12H12O4/c13-11-9-2-1-3-10(8(9)4-5-14-11)12-15-6-7-16-12/h1-3,12H,4-7H2 |
| InChIKey | IRTUSGQIRLRMRP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one?
The IUPAC name of 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one (CID 118726457) is 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one.
What is the SMILES notation for 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one?
The canonical SMILES for 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one is O=C1OCCc2c1cccc2C1OCCO1.
What is the InChIKey of 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one?
The InChIKey is IRTUSGQIRLRMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O4/c13-11-9-2-1-3-10(8(9)4-5-14-11)12-15-6-7-16-12/h1-3,12H,4-7H2.
What are the key properties of 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one?
5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one has a molecular weight of 220.22 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dioxolan-2-yl)-3,4-dihydroisochromen-1-one is sourced from PubChem (CID 118726457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).