C27H24N6O2 — CID 118728170
3-[[3-oxo-3-(1,10-phenanthrolin-2-ylamino)propyl]amino]-N-quinolin-2-ylpropanamide (PubChem CID 118728170) has the molecular formula C27H24N6O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 3-[[3-oxo-3-(1,10-phenanthrolin-2-ylamino)propyl]amino]-N-quinolin-2-ylpropanamide.
| Compound Name | 3-[[3-oxo-3-(1,10-phenanthrolin-2-ylamino)propyl]amino]-N-quinolin-2-ylpropanamide |
|---|---|
| PubChem CID | 118728170 |
| Molecular Formula | C27H24N6O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 3-[[3-oxo-3-(1,10-phenanthrolin-2-ylamino)propyl]amino]-N-quinolin-2-ylpropanamide |
| SMILES | O=C(CCNCCC(=O)Nc1ccc2ccc3cccnc3c2n1)Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C27H24N6O2/c34-24(31-22-11-9-18-4-1-2-6-21(18)30-22)13-16-28-17-14-25(35)32-23-12-10-20-8-7-19-5-3-15-29-26(19)27(20)33-23/h1-12,15,28H,13-14,16-17H2,(H,30,31,34)(H,32,33,35) |
| InChIKey | PXBLDEJCXJJMIT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|