About methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate
methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate (PubChem CID 118728666) has the molecular formula C16H13N3O5
and a molecular weight of 327.30 g/mol. Its IUPAC name is methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate |
| PubChem CID | 118728666 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2ccc(C(=O)c3ccc(O)cc3O)cc2[nH]1 |
| InChI | InChI=1S/C16H13N3O5/c1-24-16(23)19-15-17-11-5-2-8(6-12(11)18-15)14(22)10-4-3-9(20)7-13(10)21/h2-7,20-21H,1H3,(H2,17,18,19,23) |
| InChIKey | ITGVFHVUPICVMK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate?
The IUPAC name of methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate (CID 118728666) is methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate.
What is the SMILES notation for methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate?
The canonical SMILES for methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate is COC(=O)Nc1nc2ccc(C(=O)c3ccc(O)cc3O)cc2[nH]1.
What is the InChIKey of methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate?
The InChIKey is ITGVFHVUPICVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O5/c1-24-16(23)19-15-17-11-5-2-8(6-12(11)18-15)14(22)10-4-3-9(20)7-13(10)21/h2-7,20-21H,1H3,(H2,17,18,19,23).
What are the key properties of methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate?
methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate has a molecular weight of 327.30 g/mol, XLogP of 2.38, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[6-(2,4-dihydroxybenzoyl)-1H-benzimidazol-2-yl]carbamate is sourced from PubChem (CID 118728666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).