C13H11N3O5 — CID 10334341
prop-2-enoyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate (PubChem CID 10334341) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is prop-2-enoyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate.
| Compound Name | prop-2-enoyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 10334341 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | prop-2-enoyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate |
| SMILES | C=CC(=O)OC(=O)c1ccc2nc(NC(=O)OC)[nH]c2c1 |
| InChI | InChI=1S/C13H11N3O5/c1-3-10(17)21-11(18)7-4-5-8-9(6-7)15-12(14-8)16-13(19)20-2/h3-6H,1H2,2H3,(H2,14,15,16,19) |
| InChIKey | BCJHYGNBURACRD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|