C18H18O3S — CID 118729382
6-(4-tert-butylphenyl)-1,2λ6-benzoxathiine 2,2-dioxide (PubChem CID 118729382) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 6-(4-tert-butylphenyl)-1,2λ6-benzoxathiine 2,2-dioxide.
| Compound Name | 6-(4-tert-butylphenyl)-1,2λ6-benzoxathiine 2,2-dioxide |
|---|---|
| PubChem CID | 118729382 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 6-(4-tert-butylphenyl)-1,2λ6-benzoxathiine 2,2-dioxide |
| SMILES | CC(C)(C)c1ccc(-c2ccc3c(c2)C=CS(=O)(=O)O3)cc1 |
| InChI | InChI=1S/C18H18O3S/c1-18(2,3)16-7-4-13(5-8-16)14-6-9-17-15(12-14)10-11-22(19,20)21-17/h4-12H,1-3H3 |
| InChIKey | VDNMSHYSRMVJFG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|