C24H18Cl4N4O — CID 118729445
2-(2,4-dichlorophenyl)-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-1-propylbenzimidazole-5-carboxamide (PubChem CID 118729445) has the molecular formula C24H18Cl4N4O and a molecular weight of 520.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-1-propylbenzimidazole-5-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-1-propylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 118729445 |
| Molecular Formula | C24H18Cl4N4O |
| Molecular Weight | 520.25 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-1-propylbenzimidazole-5-carboxamide |
| SMILES | CCCn1c(-c2ccc(Cl)cc2Cl)nc2cc(C(=O)N/N=C/c3cccc(Cl)c3Cl)ccc21 |
| InChI | InChI=1S/C24H18Cl4N4O/c1-2-10-32-21-9-6-14(24(33)31-29-13-15-4-3-5-18(26)22(15)28)11-20(21)30-23(32)17-8-7-16(25)12-19(17)27/h3-9,11-13H,2,10H2,1H3,(H,31,33)/b29-13+ |
| InChIKey | HGYCFTAAMBTUHV-VFLNYLIXSA-N |
| XLogP | 7.49 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.25 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|