C28H30N6O8 — CID 118731466
3-[3-methoxy-4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyphenyl]-5-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole-2-carbaldehyde (PubChem CID 118731466) has the molecular formula C28H30N6O8 and a molecular weight of 578.58 g/mol. Its IUPAC name is 3-[3-methoxy-4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyphenyl]-5-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole-2-carbaldehyde.
| Compound Name | 3-[3-methoxy-4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyphenyl]-5-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole-2-carbaldehyde |
|---|---|
| PubChem CID | 118731466 |
| Molecular Formula | C28H30N6O8 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 3-[3-methoxy-4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyphenyl]-5-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole-2-carbaldehyde |
| SMILES | COc1cc(C2CC(c3cc(OC)c(OC)c(OC)c3)=NN2C=O)ccc1Oc1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| InChI | InChI=1S/C28H30N6O8/c1-31-23-25(32(2)28(37)33(3)26(23)36)29-27(31)42-19-9-8-15(10-20(19)38-4)18-13-17(30-34(18)14-35)16-11-21(39-5)24(41-7)22(12-16)40-6/h8-12,14,18H,13H2,1-7H3 |
| InChIKey | OFWLJMKWANGWHE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 140.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|