C26H31NO2 — CID 11873393
[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (1S)-2,2-diphenylcyclopropane-1-carboxylate (PubChem CID 11873393) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (1S)-2,2-diphenylcyclopropane-1-carboxylate.
| Compound Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (1S)-2,2-diphenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11873393 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (1S)-2,2-diphenylcyclopropane-1-carboxylate |
| SMILES | O=C(OC[C@@H]1CCCN2CCCC[C@H]12)[C@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31NO2/c28-25(29-19-20-10-9-17-27-16-8-7-15-24(20)27)23-18-26(23,21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-6,11-14,20,23-24H,7-10,15-19H2/t20-,23+,24+/m0/s1 |
| InChIKey | KHFKPQUVHDDJDC-TUACAJSNSA-N |
| XLogP | 4.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |