C33H26BrN5S — CID 118734039
(E)-N-[(E)-[1,3-bis(4-methylphenyl)pyrazol-4-yl]methylideneamino]-4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-imine (PubChem CID 118734039) has the molecular formula C33H26BrN5S and a molecular weight of 604.58 g/mol. Its IUPAC name is (E)-N-[(E)-[1,3-bis(4-methylphenyl)pyrazol-4-yl]methylideneamino]-4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-imine.
| Compound Name | (E)-N-[(E)-[1,3-bis(4-methylphenyl)pyrazol-4-yl]methylideneamino]-4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 118734039 |
| Molecular Formula | C33H26BrN5S |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | (E)-N-[(E)-[1,3-bis(4-methylphenyl)pyrazol-4-yl]methylideneamino]-4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(-c2nn(-c3ccc(C)cc3)cc2/C=N/N=c2/scc(-c3ccc(Br)cc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H26BrN5S/c1-23-8-12-26(13-9-23)32-27(21-38(37-32)29-18-10-24(2)11-19-29)20-35-36-33-39(30-6-4-3-5-7-30)31(22-40-33)25-14-16-28(34)17-15-25/h3-22H,1-2H3/b35-20+,36-33+ |
| InChIKey | FPNMARGEMMGCRD-NBCKLLQOSA-N |
| XLogP | 8.37 |
| TPSA | 47.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|