C23H19BrN4OS — CID 135729047
1-[5-[(E)-[(Z)-[4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-ylidene]hydrazinylidene]methyl]-2-methyl-1H-pyrrol-3-yl]ethanone (PubChem CID 135729047) has the molecular formula C23H19BrN4OS and a molecular weight of 479.40 g/mol. Its IUPAC name is 1-[5-[(E)-[(Z)-[4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-ylidene]hydrazinylidene]methyl]-2-methyl-1H-pyrrol-3-yl]ethanone.
| Compound Name | 1-[5-[(E)-[(Z)-[4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-ylidene]hydrazinylidene]methyl]-2-methyl-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 135729047 |
| Molecular Formula | C23H19BrN4OS |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 1-[5-[(E)-[(Z)-[4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-ylidene]hydrazinylidene]methyl]-2-methyl-1H-pyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(/C=N/N=c2\scc(-c3ccc(Br)cc3)n2-c2ccccc2)[nH]c1C |
| InChI | InChI=1S/C23H19BrN4OS/c1-15-21(16(2)29)12-19(26-15)13-25-27-23-28(20-6-4-3-5-7-20)22(14-30-23)17-8-10-18(24)11-9-17/h3-14,26H,1-2H3/b25-13+,27-23- |
| InChIKey | SRUKEJSOOJLKST-AIEGTVMNSA-N |
| XLogP | 5.74 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|