C23H35F3N4O3 — CID 118734407
(2S)-1-carbamimidoyl-N-[(4-octylphenyl)methyl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118734407) has the molecular formula C23H35F3N4O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is (2S)-1-carbamimidoyl-N-[(4-octylphenyl)methyl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-1-carbamimidoyl-N-[(4-octylphenyl)methyl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118734407 |
| Molecular Formula | C23H35F3N4O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (2S)-1-carbamimidoyl-N-[(4-octylphenyl)methyl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)N1CCC[C@H]1C(=O)NCc1ccc(CCCCCCCC)cc1 |
| InChI | InChI=1S/C21H34N4O.C2HF3O2/c1-2-3-4-5-6-7-9-17-11-13-18(14-12-17)16-24-20(26)19-10-8-15-25(19)21(22)23;3-2(4,5)1(6)7/h11-14,19H,2-10,15-16H2,1H3,(H3,22,23)(H,24,26);(H,6,7)/t19-;/m0./s1 |
| InChIKey | PTVNYNSABMCWIA-FYZYNONXSA-N |
| XLogP | 4.20 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|