C34H33N3O7 — CID 118734664
4-N-(2-aminophenyl)-1-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzene-1,4-dicarboxamide (PubChem CID 118734664) has the molecular formula C34H33N3O7 and a molecular weight of 595.65 g/mol. Its IUPAC name is 4-N-(2-aminophenyl)-1-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2-aminophenyl)-1-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 118734664 |
| Molecular Formula | C34H33N3O7 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 4-N-(2-aminophenyl)-1-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzene-1,4-dicarboxamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(=O)c1ccc(C(=O)Nc3ccccc3N)cc1)CC2 |
| InChI | InChI=1S/C34H33N3O7/c1-41-28-16-14-22-23(18-27(28)38)25(15-13-21-17-29(42-2)31(43-3)32(44-4)30(21)22)36-33(39)19-9-11-20(12-10-19)34(40)37-26-8-6-5-7-24(26)35/h5-12,14,16-18,25H,13,15,35H2,1-4H3,(H,36,39)(H,37,40)/t25-/m0/s1 |
| InChIKey | HWTSSMIDLURKPL-VWLOTQADSA-N |
| XLogP | 5.00 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|