C41H62N6 — CID 118735434
(5S)-1-(4-cyclohexylbutyl)-5-[4-[(4S)-4-(cyclohexylmethyl)-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine (PubChem CID 118735434) has the molecular formula C41H62N6 and a molecular weight of 638.99 g/mol. Its IUPAC name is (5S)-1-(4-cyclohexylbutyl)-5-[4-[(4S)-4-(cyclohexylmethyl)-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | (5S)-1-(4-cyclohexylbutyl)-5-[4-[(4S)-4-(cyclohexylmethyl)-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 118735434 |
| Molecular Formula | C41H62N6 |
| Molecular Weight | 638.99 g/mol |
| Exact Mass | 638.50 |
| IUPAC Name | (5S)-1-(4-cyclohexylbutyl)-5-[4-[(4S)-4-(cyclohexylmethyl)-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
| SMILES | [H]/N=C1\N(CCCC[C@H]2CN=C(N)N2CCCCC2CCCCC2)C[C@H](CC2CCCCC2)N1CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C41H62N6/c42-40-44-31-38(46(40)28-13-10-16-33-14-4-1-5-15-33)21-11-12-27-45-32-39(30-35-17-6-2-7-18-35)47(41(45)43)29-26-34-22-24-37(25-23-34)36-19-8-3-9-20-36/h3,8-9,19-20,22-25,33,35,38-39,43H,1-2,4-7,10-18,21,26-32H2,(H2,42,44)/b43-41+/t38-,39-/m0/s1 |
| InChIKey | WJSHHQCCJRFXAZ-SRCQLYKESA-N |
| XLogP | 8.71 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.99 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|