C43H62N6 — CID 118735444
(5S)-1-[2-(1-adamantyl)ethyl]-5-[4-[(4S)-4-(cyclohexylmethyl)-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine (PubChem CID 118735444) has the molecular formula C43H62N6 and a molecular weight of 663.01 g/mol. Its IUPAC name is (5S)-1-[2-(1-adamantyl)ethyl]-5-[4-[(4S)-4-(cyclohexylmethyl)-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | (5S)-1-[2-(1-adamantyl)ethyl]-5-[4-[(4S)-4-(cyclohexylmethyl)-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 118735444 |
| Molecular Formula | C43H62N6 |
| Molecular Weight | 663.01 g/mol |
| Exact Mass | 662.50 |
| IUPAC Name | (5S)-1-[2-(1-adamantyl)ethyl]-5-[4-[(4S)-4-(cyclohexylmethyl)-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
| SMILES | [H]/N=C1/N(CCCC[C@H]2CN=C(N)N2CCC23CC4CC(CC(C4)C2)C3)C[C@H](CC2CCCCC2)N1CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C43H62N6/c44-41-46-30-39(48(41)22-19-43-27-34-23-35(28-43)25-36(24-34)29-43)13-7-8-20-47-31-40(26-33-9-3-1-4-10-33)49(42(47)45)21-18-32-14-16-38(17-15-32)37-11-5-2-6-12-37/h2,5-6,11-12,14-17,33-36,39-40,45H,1,3-4,7-10,13,18-31H2,(H2,44,46)/b45-42-/t34?,35?,36?,39-,40-,43?/m0/s1 |
| InChIKey | ZRWUTVCAZFTFMI-FZDSCIHPSA-N |
| XLogP | 8.56 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.01 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|