C28H44O2 — CID 118735708
(1R,2R,4aS,8aS)-1-[(E,3R)-5-(2,5-dimethylphenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 118735708) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is (1R,2R,4aS,8aS)-1-[(E,3R)-5-(2,5-dimethylphenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1R,2R,4aS,8aS)-1-[(E,3R)-5-(2,5-dimethylphenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 118735708 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | (1R,2R,4aS,8aS)-1-[(E,3R)-5-(2,5-dimethylphenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | Cc1ccc(C)c(/C=C/[C@](C)(O)CC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]2(C)O)c1 |
| InChI | InChI=1S/C28H44O2/c1-20-9-10-21(2)22(19-20)11-16-26(5,29)17-12-24-27(6)15-8-14-25(3,4)23(27)13-18-28(24,7)30/h9-11,16,19,23-24,29-30H,8,12-15,17-18H2,1-7H3/b16-11+/t23-,24+,26-,27-,28+/m0/s1 |
| InChIKey | FZSZBTBWMHYGHU-FKWLJUAFSA-N |
| XLogP | 6.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |