C25H26N4O6 — CID 118736173
ethyl 5-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-nitrophenyl)pyrazole-3-carboxylate (PubChem CID 118736173) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is ethyl 5-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-nitrophenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-nitrophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 118736173 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | ethyl 5-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-nitrophenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(OC(=O)NC3CCCCC3)c2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C25H26N4O6/c1-2-34-24(30)22-16-23(28(27-22)19-11-13-20(14-12-19)29(32)33)17-7-6-10-21(15-17)35-25(31)26-18-8-4-3-5-9-18/h6-7,10-16,18H,2-5,8-9H2,1H3,(H,26,31) |
| InChIKey | ZQEBDNZWBBHKIN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|