C25H26ClN3O4 — CID 118736179
ethyl 1-(4-chlorophenyl)-5-[4-(cyclohexylcarbamoyloxy)phenyl]pyrazole-3-carboxylate (PubChem CID 118736179) has the molecular formula C25H26ClN3O4 and a molecular weight of 467.95 g/mol. Its IUPAC name is ethyl 1-(4-chlorophenyl)-5-[4-(cyclohexylcarbamoyloxy)phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(4-chlorophenyl)-5-[4-(cyclohexylcarbamoyloxy)phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 118736179 |
| Molecular Formula | C25H26ClN3O4 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | ethyl 1-(4-chlorophenyl)-5-[4-(cyclohexylcarbamoyloxy)phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(OC(=O)NC3CCCCC3)cc2)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C25H26ClN3O4/c1-2-32-24(30)22-16-23(29(28-22)20-12-10-18(26)11-13-20)17-8-14-21(15-9-17)33-25(31)27-19-6-4-3-5-7-19/h8-16,19H,2-7H2,1H3,(H,27,31) |
| InChIKey | NKUKGPJWAHQCMN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |