C16H16N4O2S2 — CID 118736993
N-(1,1-dioxothian-4-yl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine (PubChem CID 118736993) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 118736993 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine |
| SMILES | O=S1(=O)CCC(Nc2ncnc3ccc(-c4cncs4)cc23)CC1 |
| InChI | InChI=1S/C16H16N4O2S2/c21-24(22)5-3-12(4-6-24)20-16-13-7-11(15-8-17-10-23-15)1-2-14(13)18-9-19-16/h1-2,7-10,12H,3-6H2,(H,18,19,20) |
| InChIKey | HNDMAVYDWZHBTK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |