C19H12BrF3N4O2S — CID 118737097
4-[5-bromo-1-[4-(trifluoromethyl)phenyl]sulfonylindol-3-yl]pyrimidin-2-amine (PubChem CID 118737097) has the molecular formula C19H12BrF3N4O2S and a molecular weight of 497.30 g/mol. Its IUPAC name is 4-[5-bromo-1-[4-(trifluoromethyl)phenyl]sulfonylindol-3-yl]pyrimidin-2-amine.
| Compound Name | 4-[5-bromo-1-[4-(trifluoromethyl)phenyl]sulfonylindol-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 118737097 |
| Molecular Formula | C19H12BrF3N4O2S |
| Molecular Weight | 497.30 g/mol |
| Exact Mass | 495.98 |
| IUPAC Name | 4-[5-bromo-1-[4-(trifluoromethyl)phenyl]sulfonylindol-3-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2cn(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3ccc(Br)cc23)n1 |
| InChI | InChI=1S/C19H12BrF3N4O2S/c20-12-3-6-17-14(9-12)15(16-7-8-25-18(24)26-16)10-27(17)30(28,29)13-4-1-11(2-5-13)19(21,22)23/h1-10H,(H2,24,25,26) |
| InChIKey | WLSAHHOLYNSKHS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.30 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |