C22H19N5O3 — CID 118737180
4-methoxy-N-[2-[2-(2-methoxyphenyl)tetrazol-5-yl]phenyl]benzamide (PubChem CID 118737180) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-methoxy-N-[2-[2-(2-methoxyphenyl)tetrazol-5-yl]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[2-(2-methoxyphenyl)tetrazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 118737180 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-methoxy-N-[2-[2-(2-methoxyphenyl)tetrazol-5-yl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2-c2nnn(-c3ccccc3OC)n2)cc1 |
| InChI | InChI=1S/C22H19N5O3/c1-29-16-13-11-15(12-14-16)22(28)23-18-8-4-3-7-17(18)21-24-26-27(25-21)19-9-5-6-10-20(19)30-2/h3-14H,1-2H3,(H,23,28) |
| InChIKey | QTYHIDADAYBDHC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |