C25H36O3 — CID 118737362
(1R,3R,8R,10Z,12R,13S,18S,19R)-19-hydroxy-1,5,13,17,17-pentamethyl-9-methylidene-2-oxatetracyclo[10.8.0.03,8.013,18]icosa-4,10-dien-6-one (PubChem CID 118737362) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is (1R,3R,8R,10Z,12R,13S,18S,19R)-19-hydroxy-1,5,13,17,17-pentamethyl-9-methylidene-2-oxatetracyclo[10.8.0.03,8.013,18]icosa-4,10-dien-6-one.
| Compound Name | (1R,3R,8R,10Z,12R,13S,18S,19R)-19-hydroxy-1,5,13,17,17-pentamethyl-9-methylidene-2-oxatetracyclo[10.8.0.03,8.013,18]icosa-4,10-dien-6-one |
|---|---|
| PubChem CID | 118737362 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (1R,3R,8R,10Z,12R,13S,18S,19R)-19-hydroxy-1,5,13,17,17-pentamethyl-9-methylidene-2-oxatetracyclo[10.8.0.03,8.013,18]icosa-4,10-dien-6-one |
| SMILES | C=C1/C=C\[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3[C@H](O)C[C@@]2(C)O[C@@H]2C=C(C)C(=O)C[C@H]12 |
| InChI | InChI=1S/C25H36O3/c1-15-8-9-21-24(5)11-7-10-23(3,4)22(24)19(27)14-25(21,6)28-20-12-16(2)18(26)13-17(15)20/h8-9,12,17,19-22,27H,1,7,10-11,13-14H2,2-6H3/b9-8-/t17-,19-,20-,21-,22+,24-,25-/m1/s1 |
| InChIKey | MCJGRVQJFUAGKS-BMFJUFTASA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |